![[ICO]](/icons/blank.gif){kind=icon}
![[DIR]](/icons/back.gif){kind=icon}
![[TXT]](/icons/text.gif){kind=icon}
![[DIR]](/icons/folder.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| README.html | 29-Dec-2007 12:17 | 292 | |
| abdera/ | 23-Jun-2008 01:18 | - | |
| buildr/ | 28-May-2008 20:02 | - | |
| cxf/ | 10-Apr-2008 19:32 | - | |
| nmaven/ | 23-Jun-2008 01:20 | - | |
| qpid/ | 23-Jun-2008 01:20 | - | |
| river/ | 23-Jun-2008 01:22 | - | |
| tika/ | 23-Jun-2008 01:23 | - | |
| tuscany/ | 23-Jun-2008 01:23 | - | |
| uima/ | 23-Jun-2008 01:38 | - | |
The Incubator is currently under the process of transferring releases into this structure. Please do not just dive in and create a release structure without asking on the general list first.